C14H18F2N2O2 — CID 63184878
4-(ethylamino)-3,5-difluoro-N-(oxan-4-yl)benzamide (PubChem CID 63184878) has the molecular formula C14H18F2N2O2 and a molecular weight of 284.31 g/mol. Its IUPAC name is 4-(ethylamino)-3,5-difluoro-N-(oxan-4-yl)benzamide.
| Compound Name | 4-(ethylamino)-3,5-difluoro-N-(oxan-4-yl)benzamide |
|---|---|
| PubChem CID | 63184878 |
| Molecular Formula | C14H18F2N2O2 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 4-(ethylamino)-3,5-difluoro-N-(oxan-4-yl)benzamide |
| SMILES | CCNc1c(F)cc(C(=O)NC2CCOCC2)cc1F |
| InChI | InChI=1S/C14H18F2N2O2/c1-2-17-13-11(15)7-9(8-12(13)16)14(19)18-10-3-5-20-6-4-10/h7-8,10,17H,2-6H2,1H3,(H,18,19) |
| InChIKey | XQAHQXQGCOHEJR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |