C15H20F2N2O2 — CID 63362445
3,5-difluoro-N-(oxan-3-yl)-4-(propylamino)benzamide (PubChem CID 63362445) has the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. Its IUPAC name is 3,5-difluoro-N-(oxan-3-yl)-4-(propylamino)benzamide.
| Compound Name | 3,5-difluoro-N-(oxan-3-yl)-4-(propylamino)benzamide |
|---|---|
| PubChem CID | 63362445 |
| Molecular Formula | C15H20F2N2O2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 3,5-difluoro-N-(oxan-3-yl)-4-(propylamino)benzamide |
| SMILES | CCCNc1c(F)cc(C(=O)NC2CCCOC2)cc1F |
| InChI | InChI=1S/C15H20F2N2O2/c1-2-5-18-14-12(16)7-10(8-13(14)17)15(20)19-11-4-3-6-21-9-11/h7-8,11,18H,2-6,9H2,1H3,(H,19,20) |
| InChIKey | QAFKLVYDFARXOA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |