C13H15N5O — CID 114389488
4-(propylamino)-N-(1,2,4-triazin-3-yl)benzamide (PubChem CID 114389488) has the molecular formula C13H15N5O and a molecular weight of 257.30 g/mol. Its IUPAC name is 4-(propylamino)-N-(1,2,4-triazin-3-yl)benzamide.
| Compound Name | 4-(propylamino)-N-(1,2,4-triazin-3-yl)benzamide |
|---|---|
| PubChem CID | 114389488 |
| Molecular Formula | C13H15N5O |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 4-(propylamino)-N-(1,2,4-triazin-3-yl)benzamide |
| SMILES | CCCNc1ccc(C(=O)Nc2nccnn2)cc1 |
| InChI | InChI=1S/C13H15N5O/c1-2-7-14-11-5-3-10(4-6-11)12(19)17-13-15-8-9-16-18-13/h3-6,8-9,14H,2,7H2,1H3,(H,15,17,18,19) |
| InChIKey | DYJRMRUMZGXGGQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |