C12H13N5O2 — CID 114386749
3-amino-4-ethoxy-N-(1,2,4-triazin-3-yl)benzamide (PubChem CID 114386749) has the molecular formula C12H13N5O2 and a molecular weight of 259.27 g/mol. Its IUPAC name is 3-amino-4-ethoxy-N-(1,2,4-triazin-3-yl)benzamide.
| Compound Name | 3-amino-4-ethoxy-N-(1,2,4-triazin-3-yl)benzamide |
|---|---|
| PubChem CID | 114386749 |
| Molecular Formula | C12H13N5O2 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 3-amino-4-ethoxy-N-(1,2,4-triazin-3-yl)benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2nccnn2)cc1N |
| InChI | InChI=1S/C12H13N5O2/c1-2-19-10-4-3-8(7-9(10)13)11(18)16-12-14-5-6-15-17-12/h3-7H,2,13H2,1H3,(H,14,16,17,18) |
| InChIKey | YMBAXHLLQUOEQJ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|