C10H8N6O3 — CID 114389514
4-amino-3-nitro-N-(1,2,4-triazin-3-yl)benzamide (PubChem CID 114389514) has the molecular formula C10H8N6O3 and a molecular weight of 260.21 g/mol. Its IUPAC name is 4-amino-3-nitro-N-(1,2,4-triazin-3-yl)benzamide.
| Compound Name | 4-amino-3-nitro-N-(1,2,4-triazin-3-yl)benzamide |
|---|---|
| PubChem CID | 114389514 |
| Molecular Formula | C10H8N6O3 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 4-amino-3-nitro-N-(1,2,4-triazin-3-yl)benzamide |
| SMILES | Nc1ccc(C(=O)Nc2nccnn2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H8N6O3/c11-7-2-1-6(5-8(7)16(18)19)9(17)14-10-12-3-4-13-15-10/h1-5H,11H2,(H,12,14,15,17) |
| InChIKey | BMRGUPCFFUEKBT-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 136.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|