C12H11N5O3S — CID 29411788
4-amino-N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-nitrobenzamide (PubChem CID 29411788) has the molecular formula C12H11N5O3S and a molecular weight of 305.32 g/mol. Its IUPAC name is 4-amino-N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-nitrobenzamide.
| Compound Name | 4-amino-N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 29411788 |
| Molecular Formula | C12H11N5O3S |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 4-amino-N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-nitrobenzamide |
| SMILES | Nc1ccc(C(=O)Nc2nnc(C3CC3)s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11N5O3S/c13-8-4-3-7(5-9(8)17(19)20)10(18)14-12-16-15-11(21-12)6-1-2-6/h3-6H,1-2,13H2,(H,14,16,18) |
| InChIKey | PHRBBEOQGSRQJU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|