C10H9N5O3S — CID 115661232
4-amino-N-(3-methyl-1,2,4-thiadiazol-5-yl)-3-nitrobenzamide (PubChem CID 115661232) has the molecular formula C10H9N5O3S and a molecular weight of 279.28 g/mol. Its IUPAC name is 4-amino-N-(3-methyl-1,2,4-thiadiazol-5-yl)-3-nitrobenzamide.
| Compound Name | 4-amino-N-(3-methyl-1,2,4-thiadiazol-5-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 115661232 |
| Molecular Formula | C10H9N5O3S |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 4-amino-N-(3-methyl-1,2,4-thiadiazol-5-yl)-3-nitrobenzamide |
| SMILES | Cc1nsc(NC(=O)c2ccc(N)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C10H9N5O3S/c1-5-12-10(19-14-5)13-9(16)6-2-3-7(11)8(4-6)15(17)18/h2-4H,11H2,1H3,(H,12,13,14,16) |
| InChIKey | DIDOWZODMNFGQC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|