C16H14N4O3S — CID 43004313
4-amino-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-nitrobenzamide (PubChem CID 43004313) has the molecular formula C16H14N4O3S and a molecular weight of 342.38 g/mol. Its IUPAC name is 4-amino-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-nitrobenzamide.
| Compound Name | 4-amino-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 43004313 |
| Molecular Formula | C16H14N4O3S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 4-amino-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-nitrobenzamide |
| SMILES | Cc1cc(C)c2nc(NC(=O)c3ccc(N)c([N+](=O)[O-])c3)sc2c1 |
| InChI | InChI=1S/C16H14N4O3S/c1-8-5-9(2)14-13(6-8)24-16(18-14)19-15(21)10-3-4-11(17)12(7-10)20(22)23/h3-7H,17H2,1-2H3,(H,18,19,21) |
| InChIKey | OJJPKSFCVLQOGH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|