C10H7FN4O3S — CID 115661259
3-fluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)-4-nitrobenzamide (PubChem CID 115661259) has the molecular formula C10H7FN4O3S and a molecular weight of 282.26 g/mol. Its IUPAC name is 3-fluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)-4-nitrobenzamide.
| Compound Name | 3-fluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 115661259 |
| Molecular Formula | C10H7FN4O3S |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 3-fluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)-4-nitrobenzamide |
| SMILES | Cc1nsc(NC(=O)c2ccc([N+](=O)[O-])c(F)c2)n1 |
| InChI | InChI=1S/C10H7FN4O3S/c1-5-12-10(19-14-5)13-9(16)6-2-3-8(15(17)18)7(11)4-6/h2-4H,1H3,(H,12,13,14,16) |
| InChIKey | IPFYSXASJHIYQB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|