C13H7Cl2FN2O3 — CID 62680379
N-(3,4-dichlorophenyl)-3-fluoro-4-nitrobenzamide (PubChem CID 62680379) has the molecular formula C13H7Cl2FN2O3 and a molecular weight of 329.11 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-3-fluoro-4-nitrobenzamide.
| Compound Name | N-(3,4-dichlorophenyl)-3-fluoro-4-nitrobenzamide |
|---|---|
| PubChem CID | 62680379 |
| Molecular Formula | C13H7Cl2FN2O3 |
| Molecular Weight | 329.11 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | N-(3,4-dichlorophenyl)-3-fluoro-4-nitrobenzamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)c1ccc([N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C13H7Cl2FN2O3/c14-9-3-2-8(6-10(9)15)17-13(19)7-1-4-12(18(20)21)11(16)5-7/h1-6H,(H,17,19) |
| InChIKey | DXXXJTLXIZDUQW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.11 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|