C19H11Cl2N5O6 — CID 4294395
2-N,5-N-bis(3-chloro-4-nitrophenyl)pyridine-2,5-dicarboxamide (PubChem CID 4294395) has the molecular formula C19H11Cl2N5O6 and a molecular weight of 476.23 g/mol. Its IUPAC name is 2-N,5-N-bis(3-chloro-4-nitrophenyl)pyridine-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis(3-chloro-4-nitrophenyl)pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 4294395 |
| Molecular Formula | C19H11Cl2N5O6 |
| Molecular Weight | 476.23 g/mol |
| Exact Mass | 475.01 |
| IUPAC Name | 2-N,5-N-bis(3-chloro-4-nitrophenyl)pyridine-2,5-dicarboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])c(Cl)c1)c1ccc(C(=O)Nc2ccc([N+](=O)[O-])c(Cl)c2)nc1 |
| InChI | InChI=1S/C19H11Cl2N5O6/c20-13-7-11(2-5-16(13)25(29)30)23-18(27)10-1-4-15(22-9-10)19(28)24-12-3-6-17(26(31)32)14(21)8-12/h1-9H,(H,23,27)(H,24,28) |
| InChIKey | SGEMWZRPQLLPCG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 157.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.23 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|