C10H6BrF2N3OS — CID 113253817
4-bromo-2,6-difluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)benzamide (PubChem CID 113253817) has the molecular formula C10H6BrF2N3OS and a molecular weight of 334.15 g/mol. Its IUPAC name is 4-bromo-2,6-difluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)benzamide.
| Compound Name | 4-bromo-2,6-difluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 113253817 |
| Molecular Formula | C10H6BrF2N3OS |
| Molecular Weight | 334.15 g/mol |
| Exact Mass | 332.94 |
| IUPAC Name | 4-bromo-2,6-difluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)benzamide |
| SMILES | Cc1nsc(NC(=O)c2c(F)cc(Br)cc2F)n1 |
| InChI | InChI=1S/C10H6BrF2N3OS/c1-4-14-10(18-16-4)15-9(17)8-6(12)2-5(11)3-7(8)13/h2-3H,1H3,(H,14,15,16,17) |
| InChIKey | UNTDRASRFLNEJJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.15 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |