About 2-fluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)pyridine-4-carboxamide
2-fluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)pyridine-4-carboxamide (PubChem CID 115661242) has the molecular formula C9H7FN4OS
and a molecular weight of 238.25 g/mol. Its IUPAC name is 2-fluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)pyridine-4-carboxamide.
Molecular Properties
| Compound Name | 2-fluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)pyridine-4-carboxamide |
| PubChem CID | 115661242 |
| Molecular Formula | C9H7FN4OS |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 2-fluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)pyridine-4-carboxamide |
| SMILES | Cc1nsc(NC(=O)c2ccnc(F)c2)n1 |
| InChI | InChI=1S/C9H7FN4OS/c1-5-12-9(16-14-5)13-8(15)6-2-3-11-7(10)4-6/h2-4H,1H3,(H,12,13,14,15) |
| InChIKey | OHPAXDZAOMYPCD-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)pyridine-4-carboxamide?
The IUPAC name of 2-fluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)pyridine-4-carboxamide (CID 115661242) is 2-fluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)pyridine-4-carboxamide.
What is the SMILES notation for 2-fluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)pyridine-4-carboxamide?
The canonical SMILES for 2-fluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)pyridine-4-carboxamide is Cc1nsc(NC(=O)c2ccnc(F)c2)n1.
What is the InChIKey of 2-fluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)pyridine-4-carboxamide?
The InChIKey is OHPAXDZAOMYPCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7FN4OS/c1-5-12-9(16-14-5)13-8(15)6-2-3-11-7(10)4-6/h2-4H,1H3,(H,12,13,14,15).
What are the key properties of 2-fluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)pyridine-4-carboxamide?
2-fluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)pyridine-4-carboxamide has a molecular weight of 238.25 g/mol, XLogP of 1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)pyridine-4-carboxamide is sourced from PubChem (CID 115661242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).