C14H7BrF2N2OS — CID 156781452
N-(1,2-benzothiazol-3-yl)-4-bromo-2,6-difluorobenzamide (PubChem CID 156781452) has the molecular formula C14H7BrF2N2OS and a molecular weight of 369.19 g/mol. Its IUPAC name is N-(1,2-benzothiazol-3-yl)-4-bromo-2,6-difluorobenzamide.
| Compound Name | N-(1,2-benzothiazol-3-yl)-4-bromo-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 156781452 |
| Molecular Formula | C14H7BrF2N2OS |
| Molecular Weight | 369.19 g/mol |
| Exact Mass | 367.94 |
| IUPAC Name | N-(1,2-benzothiazol-3-yl)-4-bromo-2,6-difluorobenzamide |
| SMILES | O=C(Nc1nsc2ccccc12)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C14H7BrF2N2OS/c15-7-5-9(16)12(10(17)6-7)14(20)18-13-8-3-1-2-4-11(8)21-19-13/h1-6H,(H,18,19,20) |
| InChIKey | GNBBZCQRJAPMHD-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.19 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |