C17H13F4N3OS — CID 57436450
N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-3-fluoro-4-(trifluoromethyl)benzamide (PubChem CID 57436450) has the molecular formula C17H13F4N3OS and a molecular weight of 383.37 g/mol. Its IUPAC name is N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-3-fluoro-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-3-fluoro-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 57436450 |
| Molecular Formula | C17H13F4N3OS |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-3-fluoro-4-(trifluoromethyl)benzamide |
| SMILES | O=C(NCCNc1nsc2ccccc12)c1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C17H13F4N3OS/c18-13-9-10(5-6-12(13)17(19,20)21)16(25)23-8-7-22-15-11-3-1-2-4-14(11)26-24-15/h1-6,9H,7-8H2,(H,22,24)(H,23,25) |
| InChIKey | HMUMTPUIXWDYCT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|