C20H22N4O2S — CID 58726928
1-N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-4-N-propan-2-ylbenzene-1,4-dicarboxamide (PubChem CID 58726928) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is 1-N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-4-N-propan-2-ylbenzene-1,4-dicarboxamide.
| Compound Name | 1-N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-4-N-propan-2-ylbenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 58726928 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 1-N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-4-N-propan-2-ylbenzene-1,4-dicarboxamide |
| SMILES | CC(C)NC(=O)c1ccc(C(=O)NCCNc2nsc3ccccc23)cc1 |
| InChI | InChI=1S/C20H22N4O2S/c1-13(2)23-20(26)15-9-7-14(8-10-15)19(25)22-12-11-21-18-16-5-3-4-6-17(16)27-24-18/h3-10,13H,11-12H2,1-2H3,(H,21,24)(H,22,25)(H,23,26) |
| InChIKey | KMAHHFOZSDXYHP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|