C28H31N5OS — CID 57436332
N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-3-[(4-benzylpiperazin-1-yl)methyl]benzamide (PubChem CID 57436332) has the molecular formula C28H31N5OS and a molecular weight of 485.66 g/mol. Its IUPAC name is N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-3-[(4-benzylpiperazin-1-yl)methyl]benzamide.
| Compound Name | N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-3-[(4-benzylpiperazin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 57436332 |
| Molecular Formula | C28H31N5OS |
| Molecular Weight | 485.66 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-3-[(4-benzylpiperazin-1-yl)methyl]benzamide |
| SMILES | O=C(NCCNc1nsc2ccccc12)c1cccc(CN2CCN(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C28H31N5OS/c34-28(30-14-13-29-27-25-11-4-5-12-26(25)35-31-27)24-10-6-9-23(19-24)21-33-17-15-32(16-18-33)20-22-7-2-1-3-8-22/h1-12,19H,13-18,20-21H2,(H,29,31)(H,30,34) |
| InChIKey | RFJRFKYYMRQHKG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.66 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|