C15H25Cl2N3O — CID 119503445
N-[2-(methylamino)ethyl]-3-(pyrrolidin-1-ylmethyl)benzamide;dihydrochloride (PubChem CID 119503445) has the molecular formula C15H25Cl2N3O and a molecular weight of 334.29 g/mol. Its IUPAC name is N-[2-(methylamino)ethyl]-3-(pyrrolidin-1-ylmethyl)benzamide;dihydrochloride.
| Compound Name | N-[2-(methylamino)ethyl]-3-(pyrrolidin-1-ylmethyl)benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119503445 |
| Molecular Formula | C15H25Cl2N3O |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | N-[2-(methylamino)ethyl]-3-(pyrrolidin-1-ylmethyl)benzamide;dihydrochloride |
| SMILES | CNCCNC(=O)c1cccc(CN2CCCC2)c1.Cl.Cl |
| InChI | InChI=1S/C15H23N3O.2ClH/c1-16-7-8-17-15(19)14-6-4-5-13(11-14)12-18-9-2-3-10-18;;/h4-6,11,16H,2-3,7-10,12H2,1H3,(H,17,19);2*1H |
| InChIKey | NSBAAZWHWHJZPW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|