C21H31N5O — CID 118792731
3-(azepan-1-ylmethyl)-N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]benzamide (PubChem CID 118792731) has the molecular formula C21H31N5O and a molecular weight of 369.51 g/mol. Its IUPAC name is 3-(azepan-1-ylmethyl)-N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]benzamide.
| Compound Name | 3-(azepan-1-ylmethyl)-N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 118792731 |
| Molecular Formula | C21H31N5O |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 3-(azepan-1-ylmethyl)-N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]benzamide |
| SMILES | Cc1nc(C)n(CCCNC(=O)c2cccc(CN3CCCCCC3)c2)n1 |
| InChI | InChI=1S/C21H31N5O/c1-17-23-18(2)26(24-17)14-8-11-22-21(27)20-10-7-9-19(15-20)16-25-12-5-3-4-6-13-25/h7,9-10,15H,3-6,8,11-14,16H2,1-2H3,(H,22,27) |
| InChIKey | APLPUEDWZCQGOI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|