C21H27N5O2 — CID 72859517
2-cyclohexyl-N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-1,3-benzoxazole-6-carboxamide (PubChem CID 72859517) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-cyclohexyl-N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-1,3-benzoxazole-6-carboxamide.
| Compound Name | 2-cyclohexyl-N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 72859517 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 2-cyclohexyl-N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-1,3-benzoxazole-6-carboxamide |
| SMILES | Cc1nc(C)n(CCCNC(=O)c2ccc3nc(C4CCCCC4)oc3c2)n1 |
| InChI | InChI=1S/C21H27N5O2/c1-14-23-15(2)26(25-14)12-6-11-22-20(27)17-9-10-18-19(13-17)28-21(24-18)16-7-4-3-5-8-16/h9-10,13,16H,3-8,11-12H2,1-2H3,(H,22,27) |
| InChIKey | FKZOTBQUBUPODZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|