C23H24N4O2 — CID 42596394
N-[2-(1H-benzimidazol-2-yl)ethyl]-2-cyclohexyl-1,3-benzoxazole-6-carboxamide (PubChem CID 42596394) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-[2-(1H-benzimidazol-2-yl)ethyl]-2-cyclohexyl-1,3-benzoxazole-6-carboxamide.
| Compound Name | N-[2-(1H-benzimidazol-2-yl)ethyl]-2-cyclohexyl-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 42596394 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | N-[2-(1H-benzimidazol-2-yl)ethyl]-2-cyclohexyl-1,3-benzoxazole-6-carboxamide |
| SMILES | O=C(NCCc1nc2ccccc2[nH]1)c1ccc2nc(C3CCCCC3)oc2c1 |
| InChI | InChI=1S/C23H24N4O2/c28-22(24-13-12-21-25-17-8-4-5-9-18(17)26-21)16-10-11-19-20(14-16)29-23(27-19)15-6-2-1-3-7-15/h4-5,8-11,14-15H,1-3,6-7,12-13H2,(H,24,28)(H,25,26) |
| InChIKey | UEPFUGHIZGZLJK-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |