C21H23N3O — CID 17474306
N-[3-(1H-benzimidazol-2-yl)propyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide (PubChem CID 17474306) has the molecular formula C21H23N3O and a molecular weight of 333.40 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)propyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)propyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 17474306 |
| Molecular Formula | C21H23N3O |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)propyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
| SMILES | C1CCC2=C(C1)C=CC(=C2)C(=O)NCCCC3=NC4=CC=CC=C4N3 |
| InChI | InChI=1S/C21H23N3O/c25-21(17-12-11-15-6-1-2-7-16(15)14-17)22-13-5-10-20-23-18-8-3-4-9-19(18)24-20/h3-4,8-9,11-12,14H,1-2,5-7,10,13H2,(H,22,25)(H,23,24) |
| InChIKey | YWNKCMLRWPXFJD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | 454 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|