C14H20Cl2N4O — CID 119838245
1-amino-N-[3-(1H-benzimidazol-2-yl)propyl]cyclopropane-1-carboxamide;dihydrochloride (PubChem CID 119838245) has the molecular formula C14H20Cl2N4O and a molecular weight of 331.25 g/mol. Its IUPAC name is 1-amino-N-[3-(1H-benzimidazol-2-yl)propyl]cyclopropane-1-carboxamide;dihydrochloride.
| Compound Name | 1-amino-N-[3-(1H-benzimidazol-2-yl)propyl]cyclopropane-1-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119838245 |
| Molecular Formula | C14H20Cl2N4O |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 1-amino-N-[3-(1H-benzimidazol-2-yl)propyl]cyclopropane-1-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NC1(C(=O)NCCCc2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C14H18N4O.2ClH/c15-14(7-8-14)13(19)16-9-3-6-12-17-10-4-1-2-5-11(10)18-12;;/h1-2,4-5H,3,6-9,15H2,(H,16,19)(H,17,18);2*1H |
| InChIKey | DYMRJMQQRDJWTQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|