C22H28N4O — CID 71827812
N-[3-(1H-benzimidazol-2-yl)propyl]-2-(1-pyrrol-1-ylcyclohexyl)acetamide (PubChem CID 71827812) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)propyl]-2-(1-pyrrol-1-ylcyclohexyl)acetamide.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)propyl]-2-(1-pyrrol-1-ylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 71827812 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)propyl]-2-(1-pyrrol-1-ylcyclohexyl)acetamide |
| SMILES | O=C(CC1(n2cccc2)CCCCC1)NCCCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H28N4O/c27-21(17-22(12-4-1-5-13-22)26-15-6-7-16-26)23-14-8-11-20-24-18-9-2-3-10-19(18)25-20/h2-3,6-7,9-10,15-16H,1,4-5,8,11-14,17H2,(H,23,27)(H,24,25) |
| InChIKey | RDBMTQUUTXFAMC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|