C18H23N5O3 — CID 55909912
N-[3-(1H-benzimidazol-2-yl)propyl]-2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetamide (PubChem CID 55909912) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)propyl]-2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetamide.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)propyl]-2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 55909912 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)propyl]-2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetamide |
| SMILES | CCN1CCN(CC(=O)NCCCc2nc3ccccc3[nH]2)C(=O)C1=O |
| InChI | InChI=1S/C18H23N5O3/c1-2-22-10-11-23(18(26)17(22)25)12-16(24)19-9-5-8-15-20-13-6-3-4-7-14(13)21-15/h3-4,6-7H,2,5,8-12H2,1H3,(H,19,24)(H,20,21) |
| InChIKey | PRIWGMCZAQSFKH-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 98.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|