C15H19N3O — CID 29303561
trans-(1R,2R)-N-[3-(1H-benzimidazol-2-yl)propyl]-2-methylcyclopropane-1-carboxamide (PubChem CID 29303561) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is trans-(1R,2R)-N-[3-(1H-benzimidazol-2-yl)propyl]-2-methylcyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-[3-(1H-benzimidazol-2-yl)propyl]-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 29303561 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | trans-(1R,2R)-N-[3-(1H-benzimidazol-2-yl)propyl]-2-methylcyclopropane-1-carboxamide |
| SMILES | C[C@@H]1C[C@H]1C(=O)NCCCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C15H19N3O/c1-10-9-11(10)15(19)16-8-4-7-14-17-12-5-2-3-6-13(12)18-14/h2-3,5-6,10-11H,4,7-9H2,1H3,(H,16,19)(H,17,18)/t10-,11-/m1/s1 |
| InChIKey | CBXOCWISTAEELG-GHMZBOCLSA-N |
| XLogP | 2.27 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|