C15H24Cl2N4O — CID 120502679
3-amino-N-[3-(1H-benzimidazol-2-yl)propyl]-2-methylbutanamide;dihydrochloride (PubChem CID 120502679) has the molecular formula C15H24Cl2N4O and a molecular weight of 347.29 g/mol. Its IUPAC name is 3-amino-N-[3-(1H-benzimidazol-2-yl)propyl]-2-methylbutanamide;dihydrochloride.
| Compound Name | 3-amino-N-[3-(1H-benzimidazol-2-yl)propyl]-2-methylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 120502679 |
| Molecular Formula | C15H24Cl2N4O |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 3-amino-N-[3-(1H-benzimidazol-2-yl)propyl]-2-methylbutanamide;dihydrochloride |
| SMILES | CC(N)C(C)C(=O)NCCCc1nc2ccccc2[nH]1.Cl.Cl |
| InChI | InChI=1S/C15H22N4O.2ClH/c1-10(11(2)16)15(20)17-9-5-8-14-18-12-6-3-4-7-13(12)19-14;;/h3-4,6-7,10-11H,5,8-9,16H2,1-2H3,(H,17,20)(H,18,19);2*1H |
| InChIKey | FFNIKUSGKGRXFH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|