C21H26N4O2 — CID 34708595
1-[3-(1H-benzimidazol-2-yl)propyl]-3-[(2S)-4-(4-hydroxyphenyl)butan-2-yl]urea (PubChem CID 34708595) has the molecular formula C21H26N4O2 and a molecular weight of 366.46 g/mol. Its IUPAC name is 1-[3-(1H-benzimidazol-2-yl)propyl]-3-[(2S)-4-(4-hydroxyphenyl)butan-2-yl]urea.
| Compound Name | 1-[3-(1H-benzimidazol-2-yl)propyl]-3-[(2S)-4-(4-hydroxyphenyl)butan-2-yl]urea |
|---|---|
| PubChem CID | 34708595 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 1-[3-(1H-benzimidazol-2-yl)propyl]-3-[(2S)-4-(4-hydroxyphenyl)butan-2-yl]urea |
| SMILES | C[C@@H](CCc1ccc(O)cc1)NC(=O)NCCCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H26N4O2/c1-15(8-9-16-10-12-17(26)13-11-16)23-21(27)22-14-4-7-20-24-18-5-2-3-6-19(18)25-20/h2-3,5-6,10-13,15,26H,4,7-9,14H2,1H3,(H,24,25)(H2,22,23,27)/t15-/m0/s1 |
| InChIKey | LRGOCZZVRBCUQZ-HNNXBMFYSA-N |
| XLogP | 3.52 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|