C19H24Cl2N4O — CID 120669473
2-amino-N-[3-(1H-benzimidazol-2-yl)propyl]-2-(4-methylphenyl)acetamide;dihydrochloride (PubChem CID 120669473) has the molecular formula C19H24Cl2N4O and a molecular weight of 395.33 g/mol. Its IUPAC name is 2-amino-N-[3-(1H-benzimidazol-2-yl)propyl]-2-(4-methylphenyl)acetamide;dihydrochloride.
| Compound Name | 2-amino-N-[3-(1H-benzimidazol-2-yl)propyl]-2-(4-methylphenyl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 120669473 |
| Molecular Formula | C19H24Cl2N4O |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 2-amino-N-[3-(1H-benzimidazol-2-yl)propyl]-2-(4-methylphenyl)acetamide;dihydrochloride |
| SMILES | Cc1ccc(C(N)C(=O)NCCCc2nc3ccccc3[nH]2)cc1.Cl.Cl |
| InChI | InChI=1S/C19H22N4O.2ClH/c1-13-8-10-14(11-9-13)18(20)19(24)21-12-4-7-17-22-15-5-2-3-6-16(15)23-17;;/h2-3,5-6,8-11,18H,4,7,12,20H2,1H3,(H,21,24)(H,22,23);2*1H |
| InChIKey | LNEFQZHCMPNGAB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|