C18H17F2N3OS — CID 41478889
N-[3-(1H-benzimidazol-2-yl)propyl]-4-(difluoromethylsulfanyl)benzamide (PubChem CID 41478889) has the molecular formula C18H17F2N3OS and a molecular weight of 361.42 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)propyl]-4-(difluoromethylsulfanyl)benzamide.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)propyl]-4-(difluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 41478889 |
| Molecular Formula | C18H17F2N3OS |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)propyl]-4-(difluoromethylsulfanyl)benzamide |
| SMILES | O=C(NCCCc1nc2ccccc2[nH]1)c1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C18H17F2N3OS/c19-18(20)25-13-9-7-12(8-10-13)17(24)21-11-3-6-16-22-14-4-1-2-5-15(14)23-16/h1-2,4-5,7-10,18H,3,6,11H2,(H,21,24)(H,22,23) |
| InChIKey | IJKUPDGPTHVEMT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|