C14H17FN4O2 — CID 91777209
N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3-fluoro-2-hydroxybenzamide (PubChem CID 91777209) has the molecular formula C14H17FN4O2 and a molecular weight of 292.31 g/mol. Its IUPAC name is N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3-fluoro-2-hydroxybenzamide.
| Compound Name | N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3-fluoro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 91777209 |
| Molecular Formula | C14H17FN4O2 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3-fluoro-2-hydroxybenzamide |
| SMILES | Cc1nc(C)n(CCCNC(=O)c2cccc(F)c2O)n1 |
| InChI | InChI=1S/C14H17FN4O2/c1-9-17-10(2)19(18-9)8-4-7-16-14(21)11-5-3-6-12(15)13(11)20/h3,5-6,20H,4,7-8H2,1-2H3,(H,16,21) |
| InChIKey | UFSLTZVHXMWULH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|