C17H21N7O — CID 72885852
1-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3-(3-methylcinnolin-5-yl)urea (PubChem CID 72885852) has the molecular formula C17H21N7O and a molecular weight of 339.40 g/mol. Its IUPAC name is 1-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3-(3-methylcinnolin-5-yl)urea.
| Compound Name | 1-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3-(3-methylcinnolin-5-yl)urea |
|---|---|
| PubChem CID | 72885852 |
| Molecular Formula | C17H21N7O |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 1-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3-(3-methylcinnolin-5-yl)urea |
| SMILES | Cc1cc2c(NC(=O)NCCCn3nc(C)nc3C)cccc2nn1 |
| InChI | InChI=1S/C17H21N7O/c1-11-10-14-15(6-4-7-16(14)22-21-11)20-17(25)18-8-5-9-24-13(3)19-12(2)23-24/h4,6-7,10H,5,8-9H2,1-3H3,(H2,18,20,25) |
| InChIKey | BZHZRESWGCGTHP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|