C16H27N7O — CID 72917481
1-(3-tert-butyl-1-methylpyrazol-5-yl)-3-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]urea (PubChem CID 72917481) has the molecular formula C16H27N7O and a molecular weight of 333.44 g/mol. Its IUPAC name is 1-(3-tert-butyl-1-methylpyrazol-5-yl)-3-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]urea.
| Compound Name | 1-(3-tert-butyl-1-methylpyrazol-5-yl)-3-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]urea |
|---|---|
| PubChem CID | 72917481 |
| Molecular Formula | C16H27N7O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | 1-(3-tert-butyl-1-methylpyrazol-5-yl)-3-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]urea |
| SMILES | Cc1nc(C)n(CCCNC(=O)Nc2cc(C(C)(C)C)nn2C)n1 |
| InChI | InChI=1S/C16H27N7O/c1-11-18-12(2)23(20-11)9-7-8-17-15(24)19-14-10-13(16(3,4)5)21-22(14)6/h10H,7-9H2,1-6H3,(H2,17,19,24) |
| InChIKey | XRLJSHQPXMSIJK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|