C16H21N7O3 — CID 72911944
1-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3-(6-methoxy-2-oxo-1,3-dihydrobenzimidazol-5-yl)urea (PubChem CID 72911944) has the molecular formula C16H21N7O3 and a molecular weight of 359.39 g/mol. Its IUPAC name is 1-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3-(6-methoxy-2-oxo-1,3-dihydrobenzimidazol-5-yl)urea.
| Compound Name | 1-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3-(6-methoxy-2-oxo-1,3-dihydrobenzimidazol-5-yl)urea |
|---|---|
| PubChem CID | 72911944 |
| Molecular Formula | C16H21N7O3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 1-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3-(6-methoxy-2-oxo-1,3-dihydrobenzimidazol-5-yl)urea |
| SMILES | COc1cc2[nH]c(=O)[nH]c2cc1NC(=O)NCCCn1nc(C)nc1C |
| InChI | InChI=1S/C16H21N7O3/c1-9-18-10(2)23(22-9)6-4-5-17-15(24)21-13-7-11-12(8-14(13)26-3)20-16(25)19-11/h7-8H,4-6H2,1-3H3,(H2,17,21,24)(H2,19,20,25) |
| InChIKey | SCFZDYNYDKLDSS-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|