C16H20BrClN4O2 — CID 35284622
1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3-(5-chloro-2-methoxyphenyl)urea (PubChem CID 35284622) has the molecular formula C16H20BrClN4O2 and a molecular weight of 415.72 g/mol. Its IUPAC name is 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3-(5-chloro-2-methoxyphenyl)urea.
| Compound Name | 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3-(5-chloro-2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 35284622 |
| Molecular Formula | C16H20BrClN4O2 |
| Molecular Weight | 415.72 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3-(5-chloro-2-methoxyphenyl)urea |
| SMILES | COc1ccc(Cl)cc1NC(=O)NCCCn1nc(C)c(Br)c1C |
| InChI | InChI=1S/C16H20BrClN4O2/c1-10-15(17)11(2)22(21-10)8-4-7-19-16(23)20-13-9-12(18)5-6-14(13)24-3/h5-6,9H,4,7-8H2,1-3H3,(H2,19,20,23) |
| InChIKey | ZGAIWTBUMLJFHM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.72 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|