C22H29ClN4O2 — CID 55696937
1-[3-(4-benzylpiperazin-1-yl)propyl]-3-(5-chloro-2-methoxyphenyl)urea (PubChem CID 55696937) has the molecular formula C22H29ClN4O2 and a molecular weight of 416.95 g/mol. Its IUPAC name is 1-[3-(4-benzylpiperazin-1-yl)propyl]-3-(5-chloro-2-methoxyphenyl)urea.
| Compound Name | 1-[3-(4-benzylpiperazin-1-yl)propyl]-3-(5-chloro-2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 55696937 |
| Molecular Formula | C22H29ClN4O2 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 1-[3-(4-benzylpiperazin-1-yl)propyl]-3-(5-chloro-2-methoxyphenyl)urea |
| SMILES | COc1ccc(Cl)cc1NC(=O)NCCCN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H29ClN4O2/c1-29-21-9-8-19(23)16-20(21)25-22(28)24-10-5-11-26-12-14-27(15-13-26)17-18-6-3-2-4-7-18/h2-4,6-9,16H,5,10-15,17H2,1H3,(H2,24,25,28) |
| InChIKey | SBYLLTKZYCMLHG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|