C24H35N5O — CID 55704765
1-[3-(4-benzylpiperazin-1-yl)propyl]-3-[4-(dimethylamino)-2-methylphenyl]urea (PubChem CID 55704765) has the molecular formula C24H35N5O and a molecular weight of 409.58 g/mol. Its IUPAC name is 1-[3-(4-benzylpiperazin-1-yl)propyl]-3-[4-(dimethylamino)-2-methylphenyl]urea.
| Compound Name | 1-[3-(4-benzylpiperazin-1-yl)propyl]-3-[4-(dimethylamino)-2-methylphenyl]urea |
|---|---|
| PubChem CID | 55704765 |
| Molecular Formula | C24H35N5O |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | 1-[3-(4-benzylpiperazin-1-yl)propyl]-3-[4-(dimethylamino)-2-methylphenyl]urea |
| SMILES | Cc1cc(N(C)C)ccc1NC(=O)NCCCN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H35N5O/c1-20-18-22(27(2)3)10-11-23(20)26-24(30)25-12-7-13-28-14-16-29(17-15-28)19-21-8-5-4-6-9-21/h4-6,8-11,18H,7,12-17,19H2,1-3H3,(H2,25,26,30) |
| InChIKey | VBTXRFYDYQHKPU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|