C23H30N4O3 — CID 86886318
1-[4-(dimethylamino)-2-methylphenyl]-3-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)urea (PubChem CID 86886318) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is 1-[4-(dimethylamino)-2-methylphenyl]-3-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)urea.
| Compound Name | 1-[4-(dimethylamino)-2-methylphenyl]-3-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)urea |
|---|---|
| PubChem CID | 86886318 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 1-[4-(dimethylamino)-2-methylphenyl]-3-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)urea |
| SMILES | Cc1cc(N(C)C)ccc1NC(=O)NCC(C(=O)N1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C23H30N4O3/c1-17-15-19(26(2)3)9-10-21(17)25-23(29)24-16-20(18-7-5-4-6-8-18)22(28)27-11-13-30-14-12-27/h4-10,15,20H,11-14,16H2,1-3H3,(H2,24,25,29) |
| InChIKey | CBJLYLAHTZOROB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|