C23H36N4O3 — CID 86886149
1-[1-(2-methylpropyl)piperidin-4-yl]-3-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)urea (PubChem CID 86886149) has the molecular formula C23H36N4O3 and a molecular weight of 416.57 g/mol. Its IUPAC name is 1-[1-(2-methylpropyl)piperidin-4-yl]-3-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)urea.
| Compound Name | 1-[1-(2-methylpropyl)piperidin-4-yl]-3-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)urea |
|---|---|
| PubChem CID | 86886149 |
| Molecular Formula | C23H36N4O3 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | 1-[1-(2-methylpropyl)piperidin-4-yl]-3-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)urea |
| SMILES | CC(C)CN1CCC(NC(=O)NCC(C(=O)N2CCOCC2)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H36N4O3/c1-18(2)17-26-10-8-20(9-11-26)25-23(29)24-16-21(19-6-4-3-5-7-19)22(28)27-12-14-30-15-13-27/h3-7,18,20-21H,8-17H2,1-2H3,(H2,24,25,29) |
| InChIKey | LEEKZERRWRHBMH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |