C23H34N4O3 — CID 86886437
N-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)-4-pyrrolidin-1-ylpiperidine-1-carboxamide (PubChem CID 86886437) has the molecular formula C23H34N4O3 and a molecular weight of 414.55 g/mol. Its IUPAC name is N-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)-4-pyrrolidin-1-ylpiperidine-1-carboxamide.
| Compound Name | N-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)-4-pyrrolidin-1-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 86886437 |
| Molecular Formula | C23H34N4O3 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | N-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)-4-pyrrolidin-1-ylpiperidine-1-carboxamide |
| SMILES | O=C(NCC(C(=O)N1CCOCC1)c1ccccc1)N1CCC(N2CCCC2)CC1 |
| InChI | InChI=1S/C23H34N4O3/c28-22(26-14-16-30-17-15-26)21(19-6-2-1-3-7-19)18-24-23(29)27-12-8-20(9-13-27)25-10-4-5-11-25/h1-3,6-7,20-21H,4-5,8-18H2,(H,24,29) |
| InChIKey | KOCNRIVGXCKAJA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |