C22H33N3O — CID 46978264
2-phenyl-2-piperidin-1-yl-1-(4-pyrrolidin-1-ylpiperidin-1-yl)ethanone (PubChem CID 46978264) has the molecular formula C22H33N3O and a molecular weight of 355.53 g/mol. Its IUPAC name is 2-phenyl-2-piperidin-1-yl-1-(4-pyrrolidin-1-ylpiperidin-1-yl)ethanone.
| Compound Name | 2-phenyl-2-piperidin-1-yl-1-(4-pyrrolidin-1-ylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 46978264 |
| Molecular Formula | C22H33N3O |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.26 |
| IUPAC Name | 2-phenyl-2-piperidin-1-yl-1-(4-pyrrolidin-1-ylpiperidin-1-yl)ethanone |
| SMILES | O=C(C(c1ccccc1)N1CCCCC1)N1CCC(N2CCCC2)CC1 |
| InChI | InChI=1S/C22H33N3O/c26-22(25-17-11-20(12-18-25)23-13-7-8-14-23)21(19-9-3-1-4-10-19)24-15-5-2-6-16-24/h1,3-4,9-10,20-21H,2,5-8,11-18H2 |
| InChIKey | YDLSLTVBMWCJDC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |