C24H29N3O2 — CID 8597142
(2S)-2-(4-benzoylpiperazin-1-yl)-2-phenyl-1-piperidin-1-ylethanone (PubChem CID 8597142) has the molecular formula C24H29N3O2 and a molecular weight of 391.51 g/mol. Its IUPAC name is (2S)-2-(4-benzoylpiperazin-1-yl)-2-phenyl-1-piperidin-1-ylethanone.
| Compound Name | (2S)-2-(4-benzoylpiperazin-1-yl)-2-phenyl-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 8597142 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | (2S)-2-(4-benzoylpiperazin-1-yl)-2-phenyl-1-piperidin-1-ylethanone |
| SMILES | O=C(c1ccccc1)N1CCN([C@H](C(=O)N2CCCCC2)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H29N3O2/c28-23(21-12-6-2-7-13-21)27-18-16-25(17-19-27)22(20-10-4-1-5-11-20)24(29)26-14-8-3-9-15-26/h1-2,4-7,10-13,22H,3,8-9,14-19H2/t22-/m0/s1 |
| InChIKey | LBFPNWLUWCDQKV-QFIPXVFZSA-N |
| XLogP | 3.20 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |