C22H32N4O3 — CID 86947783
3-methyl-N-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide (PubChem CID 86947783) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is 3-methyl-N-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide.
| Compound Name | 3-methyl-N-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 86947783 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 3-methyl-N-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide |
| SMILES | CC1CN2CCCC2CN1C(=O)NCC(C(=O)N1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C22H32N4O3/c1-17-15-25-9-5-8-19(25)16-26(17)22(28)23-14-20(18-6-3-2-4-7-18)21(27)24-10-12-29-13-11-24/h2-4,6-7,17,19-20H,5,8-16H2,1H3,(H,23,28) |
| InChIKey | MSPPWUFVIXRLPM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |