C21H30F3N5O2 — CID 111914194
2-methyl-1-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111914194) has the molecular formula C21H30F3N5O2 and a molecular weight of 441.50 g/mol. Its IUPAC name is 2-methyl-1-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 2-methyl-1-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111914194 |
| Molecular Formula | C21H30F3N5O2 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 2-methyl-1-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | C/N=C(/NCC(C(=O)N1CCOCC1)c1ccccc1)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C21H30F3N5O2/c1-25-20(27-17-7-8-28(14-17)15-21(22,23)24)26-13-18(16-5-3-2-4-6-16)19(30)29-9-11-31-12-10-29/h2-6,17-18H,7-15H2,1H3,(H2,25,26,27) |
| InChIKey | QDLCGNJCTCJJSN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|