C18H29F3IN5 — CID 111914923
1-[2-(dimethylamino)-2-phenylethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111914923) has the molecular formula C18H29F3IN5 and a molecular weight of 499.36 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-2-phenylethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 1-[2-(dimethylamino)-2-phenylethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111914923 |
| Molecular Formula | C18H29F3IN5 |
| Molecular Weight | 499.36 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | 1-[2-(dimethylamino)-2-phenylethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCC(c1ccccc1)N(C)C)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C18H28F3N5.HI/c1-22-17(24-15-9-10-26(12-15)13-18(19,20)21)23-11-16(25(2)3)14-7-5-4-6-8-14;/h4-8,15-16H,9-13H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | RQUTYMXTCLDGPN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|