C23H30FIN4O2 — CID 111286462
1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)guanidine;hydroiodide (PubChem CID 111286462) has the molecular formula C23H30FIN4O2 and a molecular weight of 540.42 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111286462 |
| Molecular Formula | C23H30FIN4O2 |
| Molecular Weight | 540.42 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCC(C(=O)N1CCOCC1)c1ccccc1)N(C)Cc1cccc(F)c1.I |
| InChI | InChI=1S/C23H29FN4O2.HI/c1-25-23(27(2)17-18-7-6-10-20(24)15-18)26-16-21(19-8-4-3-5-9-19)22(29)28-11-13-30-14-12-28;/h3-10,15,21H,11-14,16-17H2,1-2H3,(H,25,26);1H |
| InChIKey | PKHDJASFNIAYFI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|