C23H31IN4O2 — CID 110951665
1-benzyl-1,2-dimethyl-3-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)guanidine;hydroiodide (PubChem CID 110951665) has the molecular formula C23H31IN4O2 and a molecular weight of 522.43 g/mol. Its IUPAC name is 1-benzyl-1,2-dimethyl-3-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)guanidine;hydroiodide.
| Compound Name | 1-benzyl-1,2-dimethyl-3-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110951665 |
| Molecular Formula | C23H31IN4O2 |
| Molecular Weight | 522.43 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | 1-benzyl-1,2-dimethyl-3-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCC(C(=O)N1CCOCC1)c1ccccc1)N(C)Cc1ccccc1.I |
| InChI | InChI=1S/C23H30N4O2.HI/c1-24-23(26(2)18-19-9-5-3-6-10-19)25-17-21(20-11-7-4-8-12-20)22(28)27-13-15-29-16-14-27;/h3-12,21H,13-18H2,1-2H3,(H,24,25);1H |
| InChIKey | LYROWKYMBVFKNQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|