C26H29N3O3 — CID 86886404
1-methyl-3-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)-1-(naphthalen-1-ylmethyl)urea (PubChem CID 86886404) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is 1-methyl-3-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)-1-(naphthalen-1-ylmethyl)urea.
| Compound Name | 1-methyl-3-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)-1-(naphthalen-1-ylmethyl)urea |
|---|---|
| PubChem CID | 86886404 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 1-methyl-3-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)-1-(naphthalen-1-ylmethyl)urea |
| SMILES | CN(Cc1cccc2ccccc12)C(=O)NCC(C(=O)N1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C26H29N3O3/c1-28(19-22-12-7-11-20-10-5-6-13-23(20)22)26(31)27-18-24(21-8-3-2-4-9-21)25(30)29-14-16-32-17-15-29/h2-13,24H,14-19H2,1H3,(H,27,31) |
| InChIKey | VHTHAQXBRYEACZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |