C17H25FN4O — CID 111285361
1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-(2-oxo-2-piperidin-1-ylethyl)guanidine (PubChem CID 111285361) has the molecular formula C17H25FN4O and a molecular weight of 320.41 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-(2-oxo-2-piperidin-1-ylethyl)guanidine.
| Compound Name | 1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-(2-oxo-2-piperidin-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111285361 |
| Molecular Formula | C17H25FN4O |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-(2-oxo-2-piperidin-1-ylethyl)guanidine |
| SMILES | C/N=C(\NCC(=O)N1CCCCC1)N(C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C17H25FN4O/c1-19-17(20-12-16(23)22-9-4-3-5-10-22)21(2)13-14-7-6-8-15(18)11-14/h6-8,11H,3-5,9-10,12-13H2,1-2H3,(H,19,20) |
| InChIKey | UJSJGVOXNLLNSU-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|