C16H25FN4 — CID 111285561
1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-[(1-methylpyrrolidin-3-yl)methyl]guanidine (PubChem CID 111285561) has the molecular formula C16H25FN4 and a molecular weight of 292.40 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-[(1-methylpyrrolidin-3-yl)methyl]guanidine.
| Compound Name | 1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-[(1-methylpyrrolidin-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111285561 |
| Molecular Formula | C16H25FN4 |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.21 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-[(1-methylpyrrolidin-3-yl)methyl]guanidine |
| SMILES | C/N=C(\NCC1CCN(C)C1)N(C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C16H25FN4/c1-18-16(19-10-14-7-8-20(2)11-14)21(3)12-13-5-4-6-15(17)9-13/h4-6,9,14H,7-8,10-12H2,1-3H3,(H,18,19) |
| InChIKey | QSZCBCNPLJJAPE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|